C24H29NO4 — CID 10023609
ethyl (E,4S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-(4-phenylphenyl)pent-2-enoate (PubChem CID 10023609) has the molecular formula C24H29NO4 and a molecular weight of 395.50 g/mol. Its IUPAC name is ethyl (E,4S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-(4-phenylphenyl)pent-2-enoate.
| Compound Name | ethyl (E,4S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-(4-phenylphenyl)pent-2-enoate |
|---|---|
| PubChem CID | 10023609 |
| Molecular Formula | C24H29NO4 |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.21 |
| IUPAC Name | ethyl (E,4S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-(4-phenylphenyl)pent-2-enoate |
| SMILES | CCOC(=O)/C=C/[C@H](Cc1ccc(-c2ccccc2)cc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C24H29NO4/c1-5-28-22(26)16-15-21(25-23(27)29-24(2,3)4)17-18-11-13-20(14-12-18)19-9-7-6-8-10-19/h6-16,21H,5,17H2,1-4H3,(H,25,27)/b16-15+/t21-/m1/s1 |
| InChIKey | NESDIZXQORQEEN-UFBKIKKCSA-N |
| XLogP | 4.91 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|