C24H29NO5 — CID 69415648
methyl (4R)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-(4-phenylmethoxyphenyl)pent-2-enoate (PubChem CID 69415648) has the molecular formula C24H29NO5 and a molecular weight of 411.50 g/mol. Its IUPAC name is methyl (4R)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-(4-phenylmethoxyphenyl)pent-2-enoate.
| Compound Name | methyl (4R)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-(4-phenylmethoxyphenyl)pent-2-enoate |
|---|---|
| PubChem CID | 69415648 |
| Molecular Formula | C24H29NO5 |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 411.20 |
| IUPAC Name | methyl (4R)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-(4-phenylmethoxyphenyl)pent-2-enoate |
| SMILES | COC(=O)C=C[C@@H](Cc1ccc(OCc2ccccc2)cc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C24H29NO5/c1-24(2,3)30-23(27)25-20(12-15-22(26)28-4)16-18-10-13-21(14-11-18)29-17-19-8-6-5-7-9-19/h5-15,20H,16-17H2,1-4H3,(H,25,27)/t20-/m0/s1 |
| InChIKey | BPTLBEHKCHGNLQ-FQEVSTJZSA-N |
| XLogP | 4.43 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|