C36H44N2O7 — CID 69416239
methyl (4R)-4-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(3-phenylpropoxy)propanoyl]amino]-5-(4-phenylmethoxyphenyl)pent-2-enoate (PubChem CID 69416239) has the molecular formula C36H44N2O7 and a molecular weight of 616.76 g/mol. Its IUPAC name is methyl (4R)-4-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(3-phenylpropoxy)propanoyl]amino]-5-(4-phenylmethoxyphenyl)pent-2-enoate.
| Compound Name | methyl (4R)-4-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(3-phenylpropoxy)propanoyl]amino]-5-(4-phenylmethoxyphenyl)pent-2-enoate |
|---|---|
| PubChem CID | 69416239 |
| Molecular Formula | C36H44N2O7 |
| Molecular Weight | 616.76 g/mol |
| Exact Mass | 616.31 |
| IUPAC Name | methyl (4R)-4-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(3-phenylpropoxy)propanoyl]amino]-5-(4-phenylmethoxyphenyl)pent-2-enoate |
| SMILES | COC(=O)C=C[C@@H](Cc1ccc(OCc2ccccc2)cc1)NC(=O)[C@H](COCCCc1ccccc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C36H44N2O7/c1-36(2,3)45-35(41)38-32(26-43-23-11-16-27-12-7-5-8-13-27)34(40)37-30(19-22-33(39)42-4)24-28-17-20-31(21-18-28)44-25-29-14-9-6-10-15-29/h5-10,12-15,17-22,30,32H,11,16,23-26H2,1-4H3,(H,37,40)(H,38,41)/t30-,32-/m0/s1 |
| InChIKey | IASNXUOIQQWBDU-CDZUIXILSA-N |
| XLogP | 5.56 |
| TPSA | 112.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.76 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|