C18H25NO5 — CID 14110855
methyl (E,4S)-5-(4-methoxyphenyl)-4-[(2-methylpropan-2-yl)oxycarbonylamino]pent-2-enoate (PubChem CID 14110855) has the molecular formula C18H25NO5 and a molecular weight of 335.40 g/mol. Its IUPAC name is methyl (E,4S)-5-(4-methoxyphenyl)-4-[(2-methylpropan-2-yl)oxycarbonylamino]pent-2-enoate.
| Compound Name | methyl (E,4S)-5-(4-methoxyphenyl)-4-[(2-methylpropan-2-yl)oxycarbonylamino]pent-2-enoate |
|---|---|
| PubChem CID | 14110855 |
| Molecular Formula | C18H25NO5 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | methyl (E,4S)-5-(4-methoxyphenyl)-4-[(2-methylpropan-2-yl)oxycarbonylamino]pent-2-enoate |
| SMILES | COC(=O)/C=C/[C@H](Cc1ccc(OC)cc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H25NO5/c1-18(2,3)24-17(21)19-14(8-11-16(20)23-5)12-13-6-9-15(22-4)10-7-13/h6-11,14H,12H2,1-5H3,(H,19,21)/b11-8+/t14-/m1/s1 |
| InChIKey | CGQNDWKJKKUYPE-BMGYJQCNSA-N |
| XLogP | 2.86 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|