C18H24FNO4 — CID 134926015
methyl (E,5S)-4-fluoro-5-[(2-methylpropan-2-yl)oxycarbonylamino]-6-phenylhex-2-enoate (PubChem CID 134926015) has the molecular formula C18H24FNO4 and a molecular weight of 337.39 g/mol. Its IUPAC name is methyl (E,5S)-4-fluoro-5-[(2-methylpropan-2-yl)oxycarbonylamino]-6-phenylhex-2-enoate.
| Compound Name | methyl (E,5S)-4-fluoro-5-[(2-methylpropan-2-yl)oxycarbonylamino]-6-phenylhex-2-enoate |
|---|---|
| PubChem CID | 134926015 |
| Molecular Formula | C18H24FNO4 |
| Molecular Weight | 337.39 g/mol |
| Exact Mass | 337.17 |
| IUPAC Name | methyl (E,5S)-4-fluoro-5-[(2-methylpropan-2-yl)oxycarbonylamino]-6-phenylhex-2-enoate |
| SMILES | COC(=O)/C=C/C(F)[C@H](Cc1ccccc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H24FNO4/c1-18(2,3)24-17(22)20-15(12-13-8-6-5-7-9-13)14(19)10-11-16(21)23-4/h5-11,14-15H,12H2,1-4H3,(H,20,22)/b11-10+/t14?,15-/m0/s1 |
| InChIKey | DPLFEWZFMIMIRH-UBDJGBBTSA-N |
| XLogP | 3.19 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.39 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|