C19H27NO7S — CID 57199569
methyl (4S,5S)-5-[(2-methylpropan-2-yl)oxycarbonylamino]-4-methylsulfonyloxy-6-phenylhex-2-enoate (PubChem CID 57199569) has the molecular formula C19H27NO7S and a molecular weight of 413.49 g/mol. Its IUPAC name is methyl (4S,5S)-5-[(2-methylpropan-2-yl)oxycarbonylamino]-4-methylsulfonyloxy-6-phenylhex-2-enoate.
| Compound Name | methyl (4S,5S)-5-[(2-methylpropan-2-yl)oxycarbonylamino]-4-methylsulfonyloxy-6-phenylhex-2-enoate |
|---|---|
| PubChem CID | 57199569 |
| Molecular Formula | C19H27NO7S |
| Molecular Weight | 413.49 g/mol |
| Exact Mass | 413.15 |
| IUPAC Name | methyl (4S,5S)-5-[(2-methylpropan-2-yl)oxycarbonylamino]-4-methylsulfonyloxy-6-phenylhex-2-enoate |
| SMILES | COC(=O)C=C[C@H](OS(C)(=O)=O)[C@H](Cc1ccccc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H27NO7S/c1-19(2,3)26-18(22)20-15(13-14-9-7-6-8-10-14)16(27-28(5,23)24)11-12-17(21)25-4/h6-12,15-16H,13H2,1-5H3,(H,20,22)/t15-,16-/m0/s1 |
| InChIKey | YHSVZCLEEPWHTK-HOTGVXAUSA-N |
| XLogP | 2.20 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.49 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|