C18H27NO6S — CID 134871262
[(3R,4R)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-phenylmethoxypent-1-en-3-yl] methanesulfonate (PubChem CID 134871262) has the molecular formula C18H27NO6S and a molecular weight of 385.48 g/mol. Its IUPAC name is [(3R,4R)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-phenylmethoxypent-1-en-3-yl] methanesulfonate.
| Compound Name | [(3R,4R)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-phenylmethoxypent-1-en-3-yl] methanesulfonate |
|---|---|
| PubChem CID | 134871262 |
| Molecular Formula | C18H27NO6S |
| Molecular Weight | 385.48 g/mol |
| Exact Mass | 385.16 |
| IUPAC Name | [(3R,4R)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-phenylmethoxypent-1-en-3-yl] methanesulfonate |
| SMILES | C=C[C@@H](OS(C)(=O)=O)[C@@H](COCc1ccccc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H27NO6S/c1-6-16(25-26(5,21)22)15(19-17(20)24-18(2,3)4)13-23-12-14-10-8-7-9-11-14/h6-11,15-16H,1,12-13H2,2-5H3,(H,19,20)/t15-,16-/m1/s1 |
| InChIKey | RYZQLZWOAOJAPL-HZPDHXFCSA-N |
| XLogP | 2.63 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.48 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|