C17H23F2NO3 — CID 171548047
tert-butyl N-(3,3-difluoro-1-phenylmethoxypent-4-en-2-yl)carbamate (PubChem CID 171548047) has the molecular formula C17H23F2NO3 and a molecular weight of 327.37 g/mol. Its IUPAC name is tert-butyl N-(3,3-difluoro-1-phenylmethoxypent-4-en-2-yl)carbamate.
| Compound Name | tert-butyl N-(3,3-difluoro-1-phenylmethoxypent-4-en-2-yl)carbamate |
|---|---|
| PubChem CID | 171548047 |
| Molecular Formula | C17H23F2NO3 |
| Molecular Weight | 327.37 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | tert-butyl N-(3,3-difluoro-1-phenylmethoxypent-4-en-2-yl)carbamate |
| SMILES | C=CC(F)(F)C(COCc1ccccc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H23F2NO3/c1-5-17(18,19)14(20-15(21)23-16(2,3)4)12-22-11-13-9-7-6-8-10-13/h5-10,14H,1,11-12H2,2-4H3,(H,20,21) |
| InChIKey | FLDQQPMNHVBRAI-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.37 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|