C16H24FNO4 — CID 140879382
tert-butyl N-[(2S,3R)-3-fluoro-2-hydroxy-4-phenylmethoxybutyl]carbamate (PubChem CID 140879382) has the molecular formula C16H24FNO4 and a molecular weight of 313.37 g/mol. Its IUPAC name is tert-butyl N-[(2S,3R)-3-fluoro-2-hydroxy-4-phenylmethoxybutyl]carbamate.
| Compound Name | tert-butyl N-[(2S,3R)-3-fluoro-2-hydroxy-4-phenylmethoxybutyl]carbamate |
|---|---|
| PubChem CID | 140879382 |
| Molecular Formula | C16H24FNO4 |
| Molecular Weight | 313.37 g/mol |
| Exact Mass | 313.17 |
| IUPAC Name | tert-butyl N-[(2S,3R)-3-fluoro-2-hydroxy-4-phenylmethoxybutyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC[C@H](O)[C@H](F)COCc1ccccc1 |
| InChI | InChI=1S/C16H24FNO4/c1-16(2,3)22-15(20)18-9-14(19)13(17)11-21-10-12-7-5-4-6-8-12/h4-8,13-14,19H,9-11H2,1-3H3,(H,18,20)/t13-,14+/m1/s1 |
| InChIKey | HHNDSNMQVZVJFX-KGLIPLIRSA-N |
| XLogP | 2.43 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.37 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |