C21H36N2O6 — CID 160954727
tert-butyl N-(2-hydroxyethyl)carbamate;tert-butyl N-(2-phenylmethoxyethyl)carbamate (PubChem CID 160954727) has the molecular formula C21H36N2O6 and a molecular weight of 412.53 g/mol. Its IUPAC name is tert-butyl N-(2-hydroxyethyl)carbamate;tert-butyl N-(2-phenylmethoxyethyl)carbamate.
| Compound Name | tert-butyl N-(2-hydroxyethyl)carbamate;tert-butyl N-(2-phenylmethoxyethyl)carbamate |
|---|---|
| PubChem CID | 160954727 |
| Molecular Formula | C21H36N2O6 |
| Molecular Weight | 412.53 g/mol |
| Exact Mass | 412.26 |
| IUPAC Name | tert-butyl N-(2-hydroxyethyl)carbamate;tert-butyl N-(2-phenylmethoxyethyl)carbamate |
| SMILES | CC(C)(C)OC(=O)NCCO.CC(C)(C)OC(=O)NCCOCc1ccccc1 |
| InChI | InChI=1S/C14H21NO3.C7H15NO3/c1-14(2,3)18-13(16)15-9-10-17-11-12-7-5-4-6-8-12;1-7(2,3)11-6(10)8-4-5-9/h4-8H,9-11H2,1-3H3,(H,15,16);9H,4-5H2,1-3H3,(H,8,10) |
| InChIKey | SWFSIOSMZBFFOZ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 106.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.53 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|