C16H21NO3 — CID 131215086
tert-butyl N-[(2R)-1-phenylmethoxybut-3-yn-2-yl]carbamate (PubChem CID 131215086) has the molecular formula C16H21NO3 and a molecular weight of 275.35 g/mol. Its IUPAC name is tert-butyl N-[(2R)-1-phenylmethoxybut-3-yn-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R)-1-phenylmethoxybut-3-yn-2-yl]carbamate |
|---|---|
| PubChem CID | 131215086 |
| Molecular Formula | C16H21NO3 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | tert-butyl N-[(2R)-1-phenylmethoxybut-3-yn-2-yl]carbamate |
| SMILES | C#C[C@H](COCc1ccccc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H21NO3/c1-5-14(17-15(18)20-16(2,3)4)12-19-11-13-9-7-6-8-10-13/h1,6-10,14H,11-12H2,2-4H3,(H,17,18)/t14-/m1/s1 |
| InChIKey | QTCDDDWUHTWFGA-CQSZACIVSA-N |
| XLogP | 2.73 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|