C17H25NO4 — CID 130647619
tert-butyl N-[(2S,3S)-1-hydroxy-3-phenylmethoxypent-4-en-2-yl]carbamate (PubChem CID 130647619) has the molecular formula C17H25NO4 and a molecular weight of 307.39 g/mol. Its IUPAC name is tert-butyl N-[(2S,3S)-1-hydroxy-3-phenylmethoxypent-4-en-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S,3S)-1-hydroxy-3-phenylmethoxypent-4-en-2-yl]carbamate |
|---|---|
| PubChem CID | 130647619 |
| Molecular Formula | C17H25NO4 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.18 |
| IUPAC Name | tert-butyl N-[(2S,3S)-1-hydroxy-3-phenylmethoxypent-4-en-2-yl]carbamate |
| SMILES | C=C[C@H](OCc1ccccc1)[C@H](CO)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H25NO4/c1-5-15(21-12-13-9-7-6-8-10-13)14(11-19)18-16(20)22-17(2,3)4/h5-10,14-15,19H,1,11-12H2,2-4H3,(H,18,20)/t14-,15-/m0/s1 |
| InChIKey | ASWHNKXGSUFNOI-GJZGRUSLSA-N |
| XLogP | 2.64 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|