C16H26N2O4 — CID 130848205
tert-butyl N-[(2R,3R)-3-[benzyl(hydroxy)amino]-1-hydroxybutan-2-yl]carbamate (PubChem CID 130848205) has the molecular formula C16H26N2O4 and a molecular weight of 310.39 g/mol. Its IUPAC name is tert-butyl N-[(2R,3R)-3-[benzyl(hydroxy)amino]-1-hydroxybutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R,3R)-3-[benzyl(hydroxy)amino]-1-hydroxybutan-2-yl]carbamate |
|---|---|
| PubChem CID | 130848205 |
| Molecular Formula | C16H26N2O4 |
| Molecular Weight | 310.39 g/mol |
| Exact Mass | 310.19 |
| IUPAC Name | tert-butyl N-[(2R,3R)-3-[benzyl(hydroxy)amino]-1-hydroxybutan-2-yl]carbamate |
| SMILES | C[C@H]([C@H](CO)NC(=O)OC(C)(C)C)N(O)Cc1ccccc1 |
| InChI | InChI=1S/C16H26N2O4/c1-12(18(21)10-13-8-6-5-7-9-13)14(11-19)17-15(20)22-16(2,3)4/h5-9,12,14,19,21H,10-11H2,1-4H3,(H,17,20)/t12-,14+/m1/s1 |
| InChIKey | FGHARJFHJVYCQR-OCCSQVGLSA-N |
| XLogP | 2.15 |
| TPSA | 82.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.39 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|