C26H38N2O3 — CID 57059484
tert-butyl N-[(2R,3S)-1-(dibenzylamino)-2-hydroxy-5-methylhexan-3-yl]carbamate (PubChem CID 57059484) has the molecular formula C26H38N2O3 and a molecular weight of 426.60 g/mol. Its IUPAC name is tert-butyl N-[(2R,3S)-1-(dibenzylamino)-2-hydroxy-5-methylhexan-3-yl]carbamate.
| Compound Name | tert-butyl N-[(2R,3S)-1-(dibenzylamino)-2-hydroxy-5-methylhexan-3-yl]carbamate |
|---|---|
| PubChem CID | 57059484 |
| Molecular Formula | C26H38N2O3 |
| Molecular Weight | 426.60 g/mol |
| Exact Mass | 426.29 |
| IUPAC Name | tert-butyl N-[(2R,3S)-1-(dibenzylamino)-2-hydroxy-5-methylhexan-3-yl]carbamate |
| SMILES | CC(C)C[C@H](NC(=O)OC(C)(C)C)[C@H](O)CN(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C26H38N2O3/c1-20(2)16-23(27-25(30)31-26(3,4)5)24(29)19-28(17-21-12-8-6-9-13-21)18-22-14-10-7-11-15-22/h6-15,20,23-24,29H,16-19H2,1-5H3,(H,27,30)/t23-,24+/m0/s1 |
| InChIKey | YCYUDMJWEBJFLK-BJKOFHAPSA-N |
| XLogP | 4.99 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.60 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |