C26H45NO4 — CID 10048621
tert-butyl N-[(4R,5S,6S)-4,5-dihydroxy-2-methyl-14-phenyltetradecan-6-yl]carbamate (PubChem CID 10048621) has the molecular formula C26H45NO4 and a molecular weight of 435.65 g/mol. Its IUPAC name is tert-butyl N-[(4R,5S,6S)-4,5-dihydroxy-2-methyl-14-phenyltetradecan-6-yl]carbamate.
| Compound Name | tert-butyl N-[(4R,5S,6S)-4,5-dihydroxy-2-methyl-14-phenyltetradecan-6-yl]carbamate |
|---|---|
| PubChem CID | 10048621 |
| Molecular Formula | C26H45NO4 |
| Molecular Weight | 435.65 g/mol |
| Exact Mass | 435.33 |
| IUPAC Name | tert-butyl N-[(4R,5S,6S)-4,5-dihydroxy-2-methyl-14-phenyltetradecan-6-yl]carbamate |
| SMILES | CC(C)C[C@@H](O)[C@@H](O)[C@H](CCCCCCCCc1ccccc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C26H45NO4/c1-20(2)19-23(28)24(29)22(27-25(30)31-26(3,4)5)18-14-9-7-6-8-11-15-21-16-12-10-13-17-21/h10,12-13,16-17,20,22-24,28-29H,6-9,11,14-15,18-19H2,1-5H3,(H,27,30)/t22-,23+,24-/m0/s1 |
| InChIKey | NWKZMWIBBIFWCS-VXNXHJTFSA-N |
| XLogP | 5.62 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.65 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|