C23H31NO3 — CID 19963746
tert-butyl N-(3-hydroxy-1,6-diphenylhexyl)carbamate (PubChem CID 19963746) has the molecular formula C23H31NO3 and a molecular weight of 369.51 g/mol. Its IUPAC name is tert-butyl N-(3-hydroxy-1,6-diphenylhexyl)carbamate.
| Compound Name | tert-butyl N-(3-hydroxy-1,6-diphenylhexyl)carbamate |
|---|---|
| PubChem CID | 19963746 |
| Molecular Formula | C23H31NO3 |
| Molecular Weight | 369.51 g/mol |
| Exact Mass | 369.23 |
| IUPAC Name | tert-butyl N-(3-hydroxy-1,6-diphenylhexyl)carbamate |
| SMILES | CC(C)(C)OC(=O)NC(CC(O)CCCc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H31NO3/c1-23(2,3)27-22(26)24-21(19-14-8-5-9-15-19)17-20(25)16-10-13-18-11-6-4-7-12-18/h4-9,11-12,14-15,20-21,25H,10,13,16-17H2,1-3H3,(H,24,26) |
| InChIKey | VDPGBDQNUGEREZ-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.51 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |