C17H27NO3 — CID 10891701
tert-butyl N-[(2S,3S)-3-hydroxy-6-phenylhexan-2-yl]carbamate (PubChem CID 10891701) has the molecular formula C17H27NO3 and a molecular weight of 293.41 g/mol. Its IUPAC name is tert-butyl N-[(2S,3S)-3-hydroxy-6-phenylhexan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S,3S)-3-hydroxy-6-phenylhexan-2-yl]carbamate |
|---|---|
| PubChem CID | 10891701 |
| Molecular Formula | C17H27NO3 |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.20 |
| IUPAC Name | tert-butyl N-[(2S,3S)-3-hydroxy-6-phenylhexan-2-yl]carbamate |
| SMILES | C[C@H](NC(=O)OC(C)(C)C)[C@@H](O)CCCc1ccccc1 |
| InChI | InChI=1S/C17H27NO3/c1-13(18-16(20)21-17(2,3)4)15(19)12-8-11-14-9-6-5-7-10-14/h5-7,9-10,13,15,19H,8,11-12H2,1-4H3,(H,18,20)/t13-,15-/m0/s1 |
| InChIKey | JTRRLNDNZPNTKL-ZFWWWQNUSA-N |
| XLogP | 3.28 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |