C25H28N2O3 — CID 23354491
pyridin-3-ylmethyl N-(3-hydroxy-1,6-diphenylhexyl)carbamate (PubChem CID 23354491) has the molecular formula C25H28N2O3 and a molecular weight of 404.51 g/mol. Its IUPAC name is pyridin-3-ylmethyl N-(3-hydroxy-1,6-diphenylhexyl)carbamate.
| Compound Name | pyridin-3-ylmethyl N-(3-hydroxy-1,6-diphenylhexyl)carbamate |
|---|---|
| PubChem CID | 23354491 |
| Molecular Formula | C25H28N2O3 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.21 |
| IUPAC Name | pyridin-3-ylmethyl N-(3-hydroxy-1,6-diphenylhexyl)carbamate |
| SMILES | O=C(NC(CC(O)CCCc1ccccc1)c1ccccc1)OCc1cccnc1 |
| InChI | InChI=1S/C25H28N2O3/c28-23(15-7-11-20-9-3-1-4-10-20)17-24(22-13-5-2-6-14-22)27-25(29)30-19-21-12-8-16-26-18-21/h1-6,8-10,12-14,16,18,23-24,28H,7,11,15,17,19H2,(H,27,29) |
| InChIKey | SQSNQISPCQMDLC-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |