C27H33N3O — CID 18727468
2-amino-N-(1,7-diphenylheptan-4-yl)-3-pyridin-3-ylpropanamide (PubChem CID 18727468) has the molecular formula C27H33N3O and a molecular weight of 415.58 g/mol. Its IUPAC name is 2-amino-N-(1,7-diphenylheptan-4-yl)-3-pyridin-3-ylpropanamide.
| Compound Name | 2-amino-N-(1,7-diphenylheptan-4-yl)-3-pyridin-3-ylpropanamide |
|---|---|
| PubChem CID | 18727468 |
| Molecular Formula | C27H33N3O |
| Molecular Weight | 415.58 g/mol |
| Exact Mass | 415.26 |
| IUPAC Name | 2-amino-N-(1,7-diphenylheptan-4-yl)-3-pyridin-3-ylpropanamide |
| SMILES | NC(Cc1cccnc1)C(=O)NC(CCCc1ccccc1)CCCc1ccccc1 |
| InChI | InChI=1S/C27H33N3O/c28-26(20-24-16-9-19-29-21-24)27(31)30-25(17-7-14-22-10-3-1-4-11-22)18-8-15-23-12-5-2-6-13-23/h1-6,9-13,16,19,21,25-26H,7-8,14-15,17-18,20,28H2,(H,30,31) |
| InChIKey | OHRUUWGDCUOSCB-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.58 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |