C28H37N3O — CID 142138157
2-amino-3-pyridin-3-ylpropanal;N-methyl-1,7-diphenylheptan-4-amine (PubChem CID 142138157) has the molecular formula C28H37N3O and a molecular weight of 431.62 g/mol. Its IUPAC name is 2-amino-3-pyridin-3-ylpropanal;N-methyl-1,7-diphenylheptan-4-amine.
| Compound Name | 2-amino-3-pyridin-3-ylpropanal;N-methyl-1,7-diphenylheptan-4-amine |
|---|---|
| PubChem CID | 142138157 |
| Molecular Formula | C28H37N3O |
| Molecular Weight | 431.62 g/mol |
| Exact Mass | 431.29 |
| IUPAC Name | 2-amino-3-pyridin-3-ylpropanal;N-methyl-1,7-diphenylheptan-4-amine |
| SMILES | CNC(CCCc1ccccc1)CCCc1ccccc1.NC(C=O)Cc1cccnc1 |
| InChI | InChI=1S/C20H27N.C8H10N2O/c1-21-20(16-8-14-18-10-4-2-5-11-18)17-9-15-19-12-6-3-7-13-19;9-8(6-11)4-7-2-1-3-10-5-7/h2-7,10-13,20-21H,8-9,14-17H2,1H3;1-3,5-6,8H,4,9H2 |
| InChIKey | LSCZNLYZWRWZJB-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.62 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|