C13H20N2O2 — CID 22155280
1-pyridin-3-ylheptan-4-ylcarbamic acid (PubChem CID 22155280) has the molecular formula C13H20N2O2 and a molecular weight of 236.31 g/mol. Its IUPAC name is 1-pyridin-3-ylheptan-4-ylcarbamic acid.
| Compound Name | 1-pyridin-3-ylheptan-4-ylcarbamic acid |
|---|---|
| PubChem CID | 22155280 |
| Molecular Formula | C13H20N2O2 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.15 |
| IUPAC Name | 1-pyridin-3-ylheptan-4-ylcarbamic acid |
| SMILES | CCCC(CCCc1cccnc1)NC(=O)O |
| InChI | InChI=1S/C13H20N2O2/c1-2-5-12(15-13(16)17)8-3-6-11-7-4-9-14-10-11/h4,7,9-10,12,15H,2-3,5-6,8H2,1H3,(H,16,17) |
| InChIKey | MITYJGILDKFIRV-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |