C24H26N4O3 — CID 71185995
benzyl N-[[4-[[[(2S)-2-amino-3-pyridin-3-ylpropanoyl]amino]methyl]phenyl]methyl]carbamate (PubChem CID 71185995) has the molecular formula C24H26N4O3 and a molecular weight of 418.50 g/mol. Its IUPAC name is benzyl N-[[4-[[[(2S)-2-amino-3-pyridin-3-ylpropanoyl]amino]methyl]phenyl]methyl]carbamate.
| Compound Name | benzyl N-[[4-[[[(2S)-2-amino-3-pyridin-3-ylpropanoyl]amino]methyl]phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 71185995 |
| Molecular Formula | C24H26N4O3 |
| Molecular Weight | 418.50 g/mol |
| Exact Mass | 418.20 |
| IUPAC Name | benzyl N-[[4-[[[(2S)-2-amino-3-pyridin-3-ylpropanoyl]amino]methyl]phenyl]methyl]carbamate |
| SMILES | N[C@@H](Cc1cccnc1)C(=O)NCc1ccc(CNC(=O)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C24H26N4O3/c25-22(13-21-7-4-12-26-14-21)23(29)27-15-18-8-10-19(11-9-18)16-28-24(30)31-17-20-5-2-1-3-6-20/h1-12,14,22H,13,15-17,25H2,(H,27,29)(H,28,30)/t22-/m0/s1 |
| InChIKey | LEFKPLZPFAFDFC-QFIPXVFZSA-N |
| XLogP | 2.69 |
| TPSA | 106.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.50 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |