C30H28N2O3 — CID 21035397
benzyl N-[[4-[[(2,2-diphenylacetyl)amino]methyl]phenyl]methyl]carbamate (PubChem CID 21035397) has the molecular formula C30H28N2O3 and a molecular weight of 464.57 g/mol. Its IUPAC name is benzyl N-[[4-[[(2,2-diphenylacetyl)amino]methyl]phenyl]methyl]carbamate.
| Compound Name | benzyl N-[[4-[[(2,2-diphenylacetyl)amino]methyl]phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 21035397 |
| Molecular Formula | C30H28N2O3 |
| Molecular Weight | 464.57 g/mol |
| Exact Mass | 464.21 |
| IUPAC Name | benzyl N-[[4-[[(2,2-diphenylacetyl)amino]methyl]phenyl]methyl]carbamate |
| SMILES | O=C(NCc1ccc(CNC(=O)C(c2ccccc2)c2ccccc2)cc1)OCc1ccccc1 |
| InChI | InChI=1S/C30H28N2O3/c33-29(28(26-12-6-2-7-13-26)27-14-8-3-9-15-27)31-20-23-16-18-24(19-17-23)21-32-30(34)35-22-25-10-4-1-5-11-25/h1-19,28H,20-22H2,(H,31,33)(H,32,34) |
| InChIKey | XCQAJXKGXJOIDH-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.57 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |