benzyl N-[(4-ethylphenyl)methyl]carbamate;carbon dioxide

C18H19NO4 — CID 161469953

IUPACbenzyl N-[(4-ethylphenyl)methyl]carbamate;carbon dioxide
SMILESCCc1ccc(CNC(=O)OCc2ccccc2)cc1.O=C=O
InChIInChI=1S/C17H19NO2.CO2/c1-2-14-8-10-15(11-9-14)12-18-17(19)20-13-16-6-4-3-5-7-16;2-1-3/h3-11H,2,12-13H2,1H3,(H,18,19);
InChIKeyWCYFIOKOEGQNPZ-UHFFFAOYSA-N
MW313.35 g/mol
LogP3.09
Rot. Bonds5

About benzyl N-[(4-ethylphenyl)methyl]carbamate;carbon dioxide

benzyl N-[(4-ethylphenyl)methyl]carbamate;carbon dioxide (PubChem CID 161469953) has the molecular formula C18H19NO4 and a molecular weight of 313.35 g/mol. Its IUPAC name is benzyl N-[(4-ethylphenyl)methyl]carbamate;carbon dioxide.

Molecular Properties

Compound Namebenzyl N-[(4-ethylphenyl)methyl]carbamate;carbon dioxide
PubChem CID161469953
Molecular FormulaC18H19NO4
Molecular Weight313.35 g/mol
Exact Mass313.13
IUPAC Namebenzyl N-[(4-ethylphenyl)methyl]carbamate;carbon dioxide
SMILESCCc1ccc(CNC(=O)OCc2ccccc2)cc1.O=C=O
InChIInChI=1S/C17H19NO2.CO2/c1-2-14-8-10-15(11-9-14)12-18-17(19)20-13-16-6-4-3-5-7-16;2-1-3/h3-11H,2,12-13H2,1H3,(H,18,19);
InChIKeyWCYFIOKOEGQNPZ-UHFFFAOYSA-N
XLogP3.09
TPSA72.47 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms23
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500313.35
LogP ≤ 53.09
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze benzyl N-[(4-ethylphenyl)methyl]carbamate;carbon dioxide with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of benzyl N-[(4-ethylphenyl)methyl]carbamate;carbon dioxide?
The IUPAC name of benzyl N-[(4-ethylphenyl)methyl]carbamate;carbon dioxide (CID 161469953) is benzyl N-[(4-ethylphenyl)methyl]carbamate;carbon dioxide.
What is the SMILES notation for benzyl N-[(4-ethylphenyl)methyl]carbamate;carbon dioxide?
The canonical SMILES for benzyl N-[(4-ethylphenyl)methyl]carbamate;carbon dioxide is CCc1ccc(CNC(=O)OCc2ccccc2)cc1.O=C=O.
What is the InChIKey of benzyl N-[(4-ethylphenyl)methyl]carbamate;carbon dioxide?
The InChIKey is WCYFIOKOEGQNPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19NO2.CO2/c1-2-14-8-10-15(11-9-14)12-18-17(19)20-13-16-6-4-3-5-7-16;2-1-3/h3-11H,2,12-13H2,1H3,(H,18,19);.
What are the key properties of benzyl N-[(4-ethylphenyl)methyl]carbamate;carbon dioxide?
benzyl N-[(4-ethylphenyl)methyl]carbamate;carbon dioxide has a molecular weight of 313.35 g/mol, XLogP of 3.09, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl N-[(4-ethylphenyl)methyl]carbamate;carbon dioxide is sourced from PubChem (CID 161469953), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).