C35H37N3O5 — CID 70278550
benzyl N-[4-[(2,2-diphenylacetyl)amino]-5-[(4-methoxyphenyl)methylamino]-5-oxopentyl]carbamate (PubChem CID 70278550) has the molecular formula C35H37N3O5 and a molecular weight of 579.70 g/mol. Its IUPAC name is benzyl N-[4-[(2,2-diphenylacetyl)amino]-5-[(4-methoxyphenyl)methylamino]-5-oxopentyl]carbamate.
| Compound Name | benzyl N-[4-[(2,2-diphenylacetyl)amino]-5-[(4-methoxyphenyl)methylamino]-5-oxopentyl]carbamate |
|---|---|
| PubChem CID | 70278550 |
| Molecular Formula | C35H37N3O5 |
| Molecular Weight | 579.70 g/mol |
| Exact Mass | 579.27 |
| IUPAC Name | benzyl N-[4-[(2,2-diphenylacetyl)amino]-5-[(4-methoxyphenyl)methylamino]-5-oxopentyl]carbamate |
| SMILES | COc1ccc(CNC(=O)C(CCCNC(=O)OCc2ccccc2)NC(=O)C(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C35H37N3O5/c1-42-30-21-19-26(20-22-30)24-37-33(39)31(18-11-23-36-35(41)43-25-27-12-5-2-6-13-27)38-34(40)32(28-14-7-3-8-15-28)29-16-9-4-10-17-29/h2-10,12-17,19-22,31-32H,11,18,23-25H2,1H3,(H,36,41)(H,37,39)(H,38,40) |
| InChIKey | KGODJFGNLKAMJC-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.70 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|