C26H25N3O3 — CID 70279878
3-cyano-2-[(2,2-diphenylacetyl)amino]-N-[(4-methoxyphenyl)methyl]propanamide (PubChem CID 70279878) has the molecular formula C26H25N3O3 and a molecular weight of 427.50 g/mol. Its IUPAC name is 3-cyano-2-[(2,2-diphenylacetyl)amino]-N-[(4-methoxyphenyl)methyl]propanamide.
| Compound Name | 3-cyano-2-[(2,2-diphenylacetyl)amino]-N-[(4-methoxyphenyl)methyl]propanamide |
|---|---|
| PubChem CID | 70279878 |
| Molecular Formula | C26H25N3O3 |
| Molecular Weight | 427.50 g/mol |
| Exact Mass | 427.19 |
| IUPAC Name | 3-cyano-2-[(2,2-diphenylacetyl)amino]-N-[(4-methoxyphenyl)methyl]propanamide |
| SMILES | COc1ccc(CNC(=O)C(CC#N)NC(=O)C(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C26H25N3O3/c1-32-22-14-12-19(13-15-22)18-28-25(30)23(16-17-27)29-26(31)24(20-8-4-2-5-9-20)21-10-6-3-7-11-21/h2-15,23-24H,16,18H2,1H3,(H,28,30)(H,29,31) |
| InChIKey | WOLQZFQAIANVBX-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 91.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.50 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |