C33H34N4O3 — CID 70280287
2-[(2,2-diphenylacetyl)amino]-N-[(4-methoxyphenyl)methyl]-3-[4-(methyliminomethylamino)phenyl]propanamide (PubChem CID 70280287) has the molecular formula C33H34N4O3 and a molecular weight of 534.66 g/mol. Its IUPAC name is 2-[(2,2-diphenylacetyl)amino]-N-[(4-methoxyphenyl)methyl]-3-[4-(methyliminomethylamino)phenyl]propanamide.
| Compound Name | 2-[(2,2-diphenylacetyl)amino]-N-[(4-methoxyphenyl)methyl]-3-[4-(methyliminomethylamino)phenyl]propanamide |
|---|---|
| PubChem CID | 70280287 |
| Molecular Formula | C33H34N4O3 |
| Molecular Weight | 534.66 g/mol |
| Exact Mass | 534.26 |
| IUPAC Name | 2-[(2,2-diphenylacetyl)amino]-N-[(4-methoxyphenyl)methyl]-3-[4-(methyliminomethylamino)phenyl]propanamide |
| SMILES | C/N=C/Nc1ccc(CC(NC(=O)C(c2ccccc2)c2ccccc2)C(=O)NCc2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C33H34N4O3/c1-34-23-36-28-17-13-24(14-18-28)21-30(32(38)35-22-25-15-19-29(40-2)20-16-25)37-33(39)31(26-9-5-3-6-10-26)27-11-7-4-8-12-27/h3-20,23,30-31H,21-22H2,1-2H3,(H,34,36)(H,35,38)(H,37,39) |
| InChIKey | DRLWTZDBAZLSBV-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 91.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.66 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|