C22H30ClN3O5 — CID 131722076
benzyl N-[(4R)-4-amino-5-[[(1R)-2-hydroxy-1-(4-methoxyphenyl)ethyl]amino]-5-oxopentyl]carbamate;hydrochloride (PubChem CID 131722076) has the molecular formula C22H30ClN3O5 and a molecular weight of 451.95 g/mol. Its IUPAC name is benzyl N-[(4R)-4-amino-5-[[(1R)-2-hydroxy-1-(4-methoxyphenyl)ethyl]amino]-5-oxopentyl]carbamate;hydrochloride.
| Compound Name | benzyl N-[(4R)-4-amino-5-[[(1R)-2-hydroxy-1-(4-methoxyphenyl)ethyl]amino]-5-oxopentyl]carbamate;hydrochloride |
|---|---|
| PubChem CID | 131722076 |
| Molecular Formula | C22H30ClN3O5 |
| Molecular Weight | 451.95 g/mol |
| Exact Mass | 451.19 |
| IUPAC Name | benzyl N-[(4R)-4-amino-5-[[(1R)-2-hydroxy-1-(4-methoxyphenyl)ethyl]amino]-5-oxopentyl]carbamate;hydrochloride |
| SMILES | COc1ccc([C@H](CO)NC(=O)[C@H](N)CCCNC(=O)OCc2ccccc2)cc1.Cl |
| InChI | InChI=1S/C22H29N3O5.ClH/c1-29-18-11-9-17(10-12-18)20(14-26)25-21(27)19(23)8-5-13-24-22(28)30-15-16-6-3-2-4-7-16;/h2-4,6-7,9-12,19-20,26H,5,8,13-15,23H2,1H3,(H,24,28)(H,25,27);1H/t19-,20+;/m1./s1 |
| InChIKey | LUOUQWSCMKEINJ-FDOHDBATSA-N |
| XLogP | 2.30 |
| TPSA | 122.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.95 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|