C22H30ClN3O4 — CID 131722023
benzyl N-[(4R)-4-amino-5-[[(1R)-1-(4-methoxyphenyl)ethyl]amino]-5-oxopentyl]carbamate;hydrochloride (PubChem CID 131722023) has the molecular formula C22H30ClN3O4 and a molecular weight of 435.95 g/mol. Its IUPAC name is benzyl N-[(4R)-4-amino-5-[[(1R)-1-(4-methoxyphenyl)ethyl]amino]-5-oxopentyl]carbamate;hydrochloride.
| Compound Name | benzyl N-[(4R)-4-amino-5-[[(1R)-1-(4-methoxyphenyl)ethyl]amino]-5-oxopentyl]carbamate;hydrochloride |
|---|---|
| PubChem CID | 131722023 |
| Molecular Formula | C22H30ClN3O4 |
| Molecular Weight | 435.95 g/mol |
| Exact Mass | 435.19 |
| IUPAC Name | benzyl N-[(4R)-4-amino-5-[[(1R)-1-(4-methoxyphenyl)ethyl]amino]-5-oxopentyl]carbamate;hydrochloride |
| SMILES | COc1ccc([C@@H](C)NC(=O)[C@H](N)CCCNC(=O)OCc2ccccc2)cc1.Cl |
| InChI | InChI=1S/C22H29N3O4.ClH/c1-16(18-10-12-19(28-2)13-11-18)25-21(26)20(23)9-6-14-24-22(27)29-15-17-7-4-3-5-8-17;/h3-5,7-8,10-13,16,20H,6,9,14-15,23H2,1-2H3,(H,24,27)(H,25,26);1H/t16-,20-;/m1./s1 |
| InChIKey | INIGWAQAQROTDA-KYSFMIDTSA-N |
| XLogP | 3.33 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.95 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|