C26H35N3O6 — CID 131722030
benzyl N-[(4R)-5-[[(1R)-1-(4-hydroxyphenyl)ethyl]amino]-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentyl]carbamate (PubChem CID 131722030) has the molecular formula C26H35N3O6 and a molecular weight of 485.58 g/mol. Its IUPAC name is benzyl N-[(4R)-5-[[(1R)-1-(4-hydroxyphenyl)ethyl]amino]-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentyl]carbamate.
| Compound Name | benzyl N-[(4R)-5-[[(1R)-1-(4-hydroxyphenyl)ethyl]amino]-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentyl]carbamate |
|---|---|
| PubChem CID | 131722030 |
| Molecular Formula | C26H35N3O6 |
| Molecular Weight | 485.58 g/mol |
| Exact Mass | 485.25 |
| IUPAC Name | benzyl N-[(4R)-5-[[(1R)-1-(4-hydroxyphenyl)ethyl]amino]-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentyl]carbamate |
| SMILES | C[C@@H](NC(=O)[C@@H](CCCNC(=O)OCc1ccccc1)NC(=O)OC(C)(C)C)c1ccc(O)cc1 |
| InChI | InChI=1S/C26H35N3O6/c1-18(20-12-14-21(30)15-13-20)28-23(31)22(29-25(33)35-26(2,3)4)11-8-16-27-24(32)34-17-19-9-6-5-7-10-19/h5-7,9-10,12-15,18,22,30H,8,11,16-17H2,1-4H3,(H,27,32)(H,28,31)(H,29,33)/t18-,22-/m1/s1 |
| InChIKey | PQCBNUIAJRLXHU-XMSQKQJNSA-N |
| XLogP | 4.17 |
| TPSA | 125.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.58 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|