C27H37N3O5 — CID 131722052
benzyl N-[(4R)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxo-5-(2-phenylpropan-2-ylamino)pentyl]carbamate (PubChem CID 131722052) has the molecular formula C27H37N3O5 and a molecular weight of 483.61 g/mol. Its IUPAC name is benzyl N-[(4R)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxo-5-(2-phenylpropan-2-ylamino)pentyl]carbamate.
| Compound Name | benzyl N-[(4R)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxo-5-(2-phenylpropan-2-ylamino)pentyl]carbamate |
|---|---|
| PubChem CID | 131722052 |
| Molecular Formula | C27H37N3O5 |
| Molecular Weight | 483.61 g/mol |
| Exact Mass | 483.27 |
| IUPAC Name | benzyl N-[(4R)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxo-5-(2-phenylpropan-2-ylamino)pentyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H](CCCNC(=O)OCc1ccccc1)C(=O)NC(C)(C)c1ccccc1 |
| InChI | InChI=1S/C27H37N3O5/c1-26(2,3)35-25(33)29-22(23(31)30-27(4,5)21-15-10-7-11-16-21)17-12-18-28-24(32)34-19-20-13-8-6-9-14-20/h6-11,13-16,22H,12,17-19H2,1-5H3,(H,28,32)(H,29,33)(H,30,31)/t22-/m1/s1 |
| InChIKey | LJWQBGYEQILQPP-JOCHJYFZSA-N |
| XLogP | 4.64 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.61 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|