C33H40N4O5 — CID 71560186
benzyl N-[(4S)-4-[(4-methoxyphenyl)methylamino]-5-[[(E,2S)-5-(methylamino)-5-oxo-1-phenylpent-3-en-2-yl]amino]-5-oxopentyl]carbamate (PubChem CID 71560186) has the molecular formula C33H40N4O5 and a molecular weight of 572.71 g/mol. Its IUPAC name is benzyl N-[(4S)-4-[(4-methoxyphenyl)methylamino]-5-[[(E,2S)-5-(methylamino)-5-oxo-1-phenylpent-3-en-2-yl]amino]-5-oxopentyl]carbamate.
| Compound Name | benzyl N-[(4S)-4-[(4-methoxyphenyl)methylamino]-5-[[(E,2S)-5-(methylamino)-5-oxo-1-phenylpent-3-en-2-yl]amino]-5-oxopentyl]carbamate |
|---|---|
| PubChem CID | 71560186 |
| Molecular Formula | C33H40N4O5 |
| Molecular Weight | 572.71 g/mol |
| Exact Mass | 572.30 |
| IUPAC Name | benzyl N-[(4S)-4-[(4-methoxyphenyl)methylamino]-5-[[(E,2S)-5-(methylamino)-5-oxo-1-phenylpent-3-en-2-yl]amino]-5-oxopentyl]carbamate |
| SMILES | CNC(=O)/C=C/[C@H](Cc1ccccc1)NC(=O)[C@H](CCCNC(=O)OCc1ccccc1)NCc1ccc(OC)cc1 |
| InChI | InChI=1S/C33H40N4O5/c1-34-31(38)20-17-28(22-25-10-5-3-6-11-25)37-32(39)30(36-23-26-15-18-29(41-2)19-16-26)14-9-21-35-33(40)42-24-27-12-7-4-8-13-27/h3-8,10-13,15-20,28,30,36H,9,14,21-24H2,1-2H3,(H,34,38)(H,35,40)(H,37,39)/b20-17+/t28-,30+/m1/s1 |
| InChIKey | UZNFOWMAWBYYON-XWFBTERMSA-N |
| XLogP | 3.89 |
| TPSA | 117.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.71 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|