C31H42N4O6 — CID 90188955
benzyl 2-[[5-[[(E)-5-(methylamino)-5-oxo-1-phenylpent-3-en-2-yl]amino]-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentyl]amino]acetate (PubChem CID 90188955) has the molecular formula C31H42N4O6 and a molecular weight of 566.70 g/mol. Its IUPAC name is benzyl 2-[[5-[[(E)-5-(methylamino)-5-oxo-1-phenylpent-3-en-2-yl]amino]-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentyl]amino]acetate.
| Compound Name | benzyl 2-[[5-[[(E)-5-(methylamino)-5-oxo-1-phenylpent-3-en-2-yl]amino]-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentyl]amino]acetate |
|---|---|
| PubChem CID | 90188955 |
| Molecular Formula | C31H42N4O6 |
| Molecular Weight | 566.70 g/mol |
| Exact Mass | 566.31 |
| IUPAC Name | benzyl 2-[[5-[[(E)-5-(methylamino)-5-oxo-1-phenylpent-3-en-2-yl]amino]-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentyl]amino]acetate |
| SMILES | CNC(=O)/C=C/C(Cc1ccccc1)NC(=O)C(CCCNCC(=O)OCc1ccccc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C31H42N4O6/c1-31(2,3)41-30(39)35-26(16-11-19-33-21-28(37)40-22-24-14-9-6-10-15-24)29(38)34-25(17-18-27(36)32-4)20-23-12-7-5-8-13-23/h5-10,12-15,17-18,25-26,33H,11,16,19-22H2,1-4H3,(H,32,36)(H,34,38)(H,35,39)/b18-17+ |
| InChIKey | SSANANSUNIHFLJ-ISLYRVAYSA-N |
| XLogP | 3.02 |
| TPSA | 134.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.70 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|