C34H46N4O6 — CID 142719565
benzyl 2-[[4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxo-5-[[(E)-5-oxo-1-phenyl-5-pyrrolidin-1-ylpent-3-en-2-yl]amino]pentyl]amino]acetate (PubChem CID 142719565) has the molecular formula C34H46N4O6 and a molecular weight of 606.76 g/mol. Its IUPAC name is benzyl 2-[[4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxo-5-[[(E)-5-oxo-1-phenyl-5-pyrrolidin-1-ylpent-3-en-2-yl]amino]pentyl]amino]acetate.
| Compound Name | benzyl 2-[[4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxo-5-[[(E)-5-oxo-1-phenyl-5-pyrrolidin-1-ylpent-3-en-2-yl]amino]pentyl]amino]acetate |
|---|---|
| PubChem CID | 142719565 |
| Molecular Formula | C34H46N4O6 |
| Molecular Weight | 606.76 g/mol |
| Exact Mass | 606.34 |
| IUPAC Name | benzyl 2-[[4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxo-5-[[(E)-5-oxo-1-phenyl-5-pyrrolidin-1-ylpent-3-en-2-yl]amino]pentyl]amino]acetate |
| SMILES | CC(C)(C)OC(=O)NC(CCCNCC(=O)OCc1ccccc1)C(=O)NC(/C=C/C(=O)N1CCCC1)Cc1ccccc1 |
| InChI | InChI=1S/C34H46N4O6/c1-34(2,3)44-33(42)37-29(17-12-20-35-24-31(40)43-25-27-15-8-5-9-16-27)32(41)36-28(23-26-13-6-4-7-14-26)18-19-30(39)38-21-10-11-22-38/h4-9,13-16,18-19,28-29,35H,10-12,17,20-25H2,1-3H3,(H,36,41)(H,37,42)/b19-18+ |
| InChIKey | SLTSXCXNCXDRSJ-VHEBQXMUSA-N |
| XLogP | 3.90 |
| TPSA | 126.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.76 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|