C30H40N4O6 — CID 71717699
benzyl N-[(4R)-5-[[(E,2S)-5-(methylamino)-5-oxo-1-phenylpent-3-en-2-yl]amino]-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentyl]carbamate (PubChem CID 71717699) has the molecular formula C30H40N4O6 and a molecular weight of 552.67 g/mol. Its IUPAC name is benzyl N-[(4R)-5-[[(E,2S)-5-(methylamino)-5-oxo-1-phenylpent-3-en-2-yl]amino]-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentyl]carbamate.
| Compound Name | benzyl N-[(4R)-5-[[(E,2S)-5-(methylamino)-5-oxo-1-phenylpent-3-en-2-yl]amino]-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentyl]carbamate |
|---|---|
| PubChem CID | 71717699 |
| Molecular Formula | C30H40N4O6 |
| Molecular Weight | 552.67 g/mol |
| Exact Mass | 552.29 |
| IUPAC Name | benzyl N-[(4R)-5-[[(E,2S)-5-(methylamino)-5-oxo-1-phenylpent-3-en-2-yl]amino]-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentyl]carbamate |
| SMILES | CNC(=O)/C=C/[C@H](Cc1ccccc1)NC(=O)[C@@H](CCCNC(=O)OCc1ccccc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C30H40N4O6/c1-30(2,3)40-29(38)34-25(16-11-19-32-28(37)39-21-23-14-9-6-10-15-23)27(36)33-24(17-18-26(35)31-4)20-22-12-7-5-8-13-22/h5-10,12-15,17-18,24-25H,11,16,19-21H2,1-4H3,(H,31,35)(H,32,37)(H,33,36)(H,34,38)/b18-17+/t24-,25-/m1/s1 |
| InChIKey | CLKMDGZBRZTOGL-HJQDBSAHSA-N |
| XLogP | 3.62 |
| TPSA | 134.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.67 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|