C33H44N4O6 — CID 71720127
benzyl N-[(4R)-5-[[(2S,3E,5E)-7-(dimethylamino)-7-oxo-1-phenylhepta-3,5-dien-2-yl]amino]-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentyl]carbamate (PubChem CID 71720127) has the molecular formula C33H44N4O6 and a molecular weight of 592.74 g/mol. Its IUPAC name is benzyl N-[(4R)-5-[[(2S,3E,5E)-7-(dimethylamino)-7-oxo-1-phenylhepta-3,5-dien-2-yl]amino]-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentyl]carbamate.
| Compound Name | benzyl N-[(4R)-5-[[(2S,3E,5E)-7-(dimethylamino)-7-oxo-1-phenylhepta-3,5-dien-2-yl]amino]-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentyl]carbamate |
|---|---|
| PubChem CID | 71720127 |
| Molecular Formula | C33H44N4O6 |
| Molecular Weight | 592.74 g/mol |
| Exact Mass | 592.33 |
| IUPAC Name | benzyl N-[(4R)-5-[[(2S,3E,5E)-7-(dimethylamino)-7-oxo-1-phenylhepta-3,5-dien-2-yl]amino]-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentyl]carbamate |
| SMILES | CN(C)C(=O)/C=C/C=C/[C@H](Cc1ccccc1)NC(=O)[C@@H](CCCNC(=O)OCc1ccccc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C33H44N4O6/c1-33(2,3)43-32(41)36-28(20-14-22-34-31(40)42-24-26-17-10-7-11-18-26)30(39)35-27(23-25-15-8-6-9-16-25)19-12-13-21-29(38)37(4)5/h6-13,15-19,21,27-28H,14,20,22-24H2,1-5H3,(H,34,40)(H,35,39)(H,36,41)/b19-12+,21-13+/t27-,28-/m1/s1 |
| InChIKey | OTVOGPIRNXBFOT-RSVLVLEDSA-N |
| XLogP | 4.51 |
| TPSA | 126.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.74 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|