C22H33N3O3 — CID 69429561
tert-butyl N-[(2S)-5-oxo-1-phenyl-5-(2-pyrrolidin-1-ylethylamino)pent-3-en-2-yl]carbamate (PubChem CID 69429561) has the molecular formula C22H33N3O3 and a molecular weight of 387.52 g/mol. Its IUPAC name is tert-butyl N-[(2S)-5-oxo-1-phenyl-5-(2-pyrrolidin-1-ylethylamino)pent-3-en-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-5-oxo-1-phenyl-5-(2-pyrrolidin-1-ylethylamino)pent-3-en-2-yl]carbamate |
|---|---|
| PubChem CID | 69429561 |
| Molecular Formula | C22H33N3O3 |
| Molecular Weight | 387.52 g/mol |
| Exact Mass | 387.25 |
| IUPAC Name | tert-butyl N-[(2S)-5-oxo-1-phenyl-5-(2-pyrrolidin-1-ylethylamino)pent-3-en-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H](C=CC(=O)NCCN1CCCC1)Cc1ccccc1 |
| InChI | InChI=1S/C22H33N3O3/c1-22(2,3)28-21(27)24-19(17-18-9-5-4-6-10-18)11-12-20(26)23-13-16-25-14-7-8-15-25/h4-6,9-12,19H,7-8,13-17H2,1-3H3,(H,23,26)(H,24,27)/t19-/m1/s1 |
| InChIKey | GKFKZLPKZDAHBX-LJQANCHMSA-N |
| XLogP | 2.89 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.52 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|