C35H44N2O4 — CID 91004937
tert-butyl N-benzyl-N-[(2S,5S)-5-[(2-methylpropan-2-yl)oxycarbonylamino]-1,6-diphenylhex-3-en-2-yl]carbamate (PubChem CID 91004937) has the molecular formula C35H44N2O4 and a molecular weight of 556.75 g/mol. Its IUPAC name is tert-butyl N-benzyl-N-[(2S,5S)-5-[(2-methylpropan-2-yl)oxycarbonylamino]-1,6-diphenylhex-3-en-2-yl]carbamate.
| Compound Name | tert-butyl N-benzyl-N-[(2S,5S)-5-[(2-methylpropan-2-yl)oxycarbonylamino]-1,6-diphenylhex-3-en-2-yl]carbamate |
|---|---|
| PubChem CID | 91004937 |
| Molecular Formula | C35H44N2O4 |
| Molecular Weight | 556.75 g/mol |
| Exact Mass | 556.33 |
| IUPAC Name | tert-butyl N-benzyl-N-[(2S,5S)-5-[(2-methylpropan-2-yl)oxycarbonylamino]-1,6-diphenylhex-3-en-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H](C=C[C@H](Cc1ccccc1)N(Cc1ccccc1)C(=O)OC(C)(C)C)Cc1ccccc1 |
| InChI | InChI=1S/C35H44N2O4/c1-34(2,3)40-32(38)36-30(24-27-16-10-7-11-17-27)22-23-31(25-28-18-12-8-13-19-28)37(33(39)41-35(4,5)6)26-29-20-14-9-15-21-29/h7-23,30-31H,24-26H2,1-6H3,(H,36,38)/t30-,31-/m1/s1 |
| InChIKey | MHENLUKFXFRHBZ-FIRIVFDPSA-N |
| XLogP | 7.73 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.75 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|