C31H37NO3 — CID 15194993
tert-butyl N-[(E)-5,5-dibenzyl-6-hydroxy-1-phenylhex-3-en-2-yl]carbamate (PubChem CID 15194993) has the molecular formula C31H37NO3 and a molecular weight of 471.64 g/mol. Its IUPAC name is tert-butyl N-[(E)-5,5-dibenzyl-6-hydroxy-1-phenylhex-3-en-2-yl]carbamate.
| Compound Name | tert-butyl N-[(E)-5,5-dibenzyl-6-hydroxy-1-phenylhex-3-en-2-yl]carbamate |
|---|---|
| PubChem CID | 15194993 |
| Molecular Formula | C31H37NO3 |
| Molecular Weight | 471.64 g/mol |
| Exact Mass | 471.28 |
| IUPAC Name | tert-butyl N-[(E)-5,5-dibenzyl-6-hydroxy-1-phenylhex-3-en-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(/C=C/C(CO)(Cc1ccccc1)Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C31H37NO3/c1-30(2,3)35-29(34)32-28(21-25-13-7-4-8-14-25)19-20-31(24-33,22-26-15-9-5-10-16-26)23-27-17-11-6-12-18-27/h4-20,28,33H,21-24H2,1-3H3,(H,32,34)/b20-19+ |
| InChIKey | VRXXDZLAUFNJGW-FMQUCBEESA-N |
| XLogP | 6.14 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.64 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|