C18H24FNO4 — CID 166436682
ethyl (E)-2-fluoro-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-phenylpent-2-enoate (PubChem CID 166436682) has the molecular formula C18H24FNO4 and a molecular weight of 337.39 g/mol. Its IUPAC name is ethyl (E)-2-fluoro-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-phenylpent-2-enoate.
| Compound Name | ethyl (E)-2-fluoro-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-phenylpent-2-enoate |
|---|---|
| PubChem CID | 166436682 |
| Molecular Formula | C18H24FNO4 |
| Molecular Weight | 337.39 g/mol |
| Exact Mass | 337.17 |
| IUPAC Name | ethyl (E)-2-fluoro-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-phenylpent-2-enoate |
| SMILES | CCOC(=O)/C(F)=C\C(Cc1ccccc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H24FNO4/c1-5-23-16(21)15(19)12-14(11-13-9-7-6-8-10-13)20-17(22)24-18(2,3)4/h6-10,12,14H,5,11H2,1-4H3,(H,20,22)/b15-12+ |
| InChIKey | JGESWKUPXZGERH-NTCAYCPXSA-N |
| XLogP | 3.54 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.39 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|