C19H29FNO6P — CID 91063952
tert-butyl N-[(2R)-4-diethoxyphosphoryl-4-fluoro-1-(4-hydroxyphenyl)but-3-en-2-yl]carbamate (PubChem CID 91063952) has the molecular formula C19H29FNO6P and a molecular weight of 417.41 g/mol. Its IUPAC name is tert-butyl N-[(2R)-4-diethoxyphosphoryl-4-fluoro-1-(4-hydroxyphenyl)but-3-en-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R)-4-diethoxyphosphoryl-4-fluoro-1-(4-hydroxyphenyl)but-3-en-2-yl]carbamate |
|---|---|
| PubChem CID | 91063952 |
| Molecular Formula | C19H29FNO6P |
| Molecular Weight | 417.41 g/mol |
| Exact Mass | 417.17 |
| IUPAC Name | tert-butyl N-[(2R)-4-diethoxyphosphoryl-4-fluoro-1-(4-hydroxyphenyl)but-3-en-2-yl]carbamate |
| SMILES | CCOP(=O)(OCC)C(F)=C[C@@H](Cc1ccc(O)cc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H29FNO6P/c1-6-25-28(24,26-7-2)17(20)13-15(21-18(23)27-19(3,4)5)12-14-8-10-16(22)11-9-14/h8-11,13,15,22H,6-7,12H2,1-5H3,(H,21,23)/t15-/m1/s1 |
| InChIKey | XZZBEVBPDYIHTN-OAHLLOKOSA-N |
| XLogP | 4.91 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.41 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|