C17H28NO5P — CID 10570312
tert-butyl N-[(1S)-1-diethoxyphosphoryl-2-phenylethyl]carbamate (PubChem CID 10570312) has the molecular formula C17H28NO5P and a molecular weight of 357.39 g/mol. Its IUPAC name is tert-butyl N-[(1S)-1-diethoxyphosphoryl-2-phenylethyl]carbamate.
| Compound Name | tert-butyl N-[(1S)-1-diethoxyphosphoryl-2-phenylethyl]carbamate |
|---|---|
| PubChem CID | 10570312 |
| Molecular Formula | C17H28NO5P |
| Molecular Weight | 357.39 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | tert-butyl N-[(1S)-1-diethoxyphosphoryl-2-phenylethyl]carbamate |
| SMILES | CCOP(=O)(OCC)[C@@H](Cc1ccccc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H28NO5P/c1-6-21-24(20,22-7-2)15(13-14-11-9-8-10-12-14)18-16(19)23-17(3,4)5/h8-12,15H,6-7,13H2,1-5H3,(H,18,19)/t15-/m0/s1 |
| InChIKey | GUQJSVWFFYJZAZ-HNNXBMFYSA-N |
| XLogP | 4.35 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.39 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|