C22H37N2O7P — CID 15655170
tert-butyl N-(1-diethoxyphosphoryl-2-phenylethyl)-N-[(2-methylpropan-2-yl)oxycarbonylamino]carbamate (PubChem CID 15655170) has the molecular formula C22H37N2O7P and a molecular weight of 472.52 g/mol. Its IUPAC name is tert-butyl N-(1-diethoxyphosphoryl-2-phenylethyl)-N-[(2-methylpropan-2-yl)oxycarbonylamino]carbamate.
| Compound Name | tert-butyl N-(1-diethoxyphosphoryl-2-phenylethyl)-N-[(2-methylpropan-2-yl)oxycarbonylamino]carbamate |
|---|---|
| PubChem CID | 15655170 |
| Molecular Formula | C22H37N2O7P |
| Molecular Weight | 472.52 g/mol |
| Exact Mass | 472.23 |
| IUPAC Name | tert-butyl N-(1-diethoxyphosphoryl-2-phenylethyl)-N-[(2-methylpropan-2-yl)oxycarbonylamino]carbamate |
| SMILES | CCOP(=O)(OCC)C(Cc1ccccc1)N(NC(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H37N2O7P/c1-9-28-32(27,29-10-2)18(16-17-14-12-11-13-15-17)24(20(26)31-22(6,7)8)23-19(25)30-21(3,4)5/h11-15,18H,9-10,16H2,1-8H3,(H,23,25) |
| InChIKey | LXPFMRGEOKCXLU-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 103.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.52 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|