C24H34BrO5P — CID 157202616
bromomethylbenzene;tert-butyl 2-diethoxyphosphoryl-3-phenylpropanoate (PubChem CID 157202616) has the molecular formula C24H34BrO5P and a molecular weight of 513.41 g/mol. Its IUPAC name is bromomethylbenzene;tert-butyl 2-diethoxyphosphoryl-3-phenylpropanoate.
| Compound Name | bromomethylbenzene;tert-butyl 2-diethoxyphosphoryl-3-phenylpropanoate |
|---|---|
| PubChem CID | 157202616 |
| Molecular Formula | C24H34BrO5P |
| Molecular Weight | 513.41 g/mol |
| Exact Mass | 512.13 |
| IUPAC Name | bromomethylbenzene;tert-butyl 2-diethoxyphosphoryl-3-phenylpropanoate |
| SMILES | BrCc1ccccc1.CCOP(=O)(OCC)C(Cc1ccccc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H27O5P.C7H7Br/c1-6-20-23(19,21-7-2)15(16(18)22-17(3,4)5)13-14-11-9-8-10-12-14;8-6-7-4-2-1-3-5-7/h8-12,15H,6-7,13H2,1-5H3;1-5H,6H2 |
| InChIKey | AQYYNPVJRDZMJF-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.41 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|