C21H35N2O7P — CID 86600165
tert-butyl 2-diethoxyphosphoryl-3-[6-[(2-methylpropan-2-yl)oxycarbonylamino]-3-pyridinyl]propanoate (PubChem CID 86600165) has the molecular formula C21H35N2O7P and a molecular weight of 458.49 g/mol. Its IUPAC name is tert-butyl 2-diethoxyphosphoryl-3-[6-[(2-methylpropan-2-yl)oxycarbonylamino]-3-pyridinyl]propanoate.
| Compound Name | tert-butyl 2-diethoxyphosphoryl-3-[6-[(2-methylpropan-2-yl)oxycarbonylamino]-3-pyridinyl]propanoate |
|---|---|
| PubChem CID | 86600165 |
| Molecular Formula | C21H35N2O7P |
| Molecular Weight | 458.49 g/mol |
| Exact Mass | 458.22 |
| IUPAC Name | tert-butyl 2-diethoxyphosphoryl-3-[6-[(2-methylpropan-2-yl)oxycarbonylamino]-3-pyridinyl]propanoate |
| SMILES | CCOP(=O)(OCC)C(Cc1ccc(NC(=O)OC(C)(C)C)nc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H35N2O7P/c1-9-27-31(26,28-10-2)16(18(24)29-20(3,4)5)13-15-11-12-17(22-14-15)23-19(25)30-21(6,7)8/h11-12,14,16H,9-10,13H2,1-8H3,(H,22,23,25) |
| InChIKey | GVISZIMFGUOATP-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 113.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.49 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|