C21H27N2O8P — CID 90975705
2-[[hydroperoxy(phenylmethoxy)phosphoryl]methyl]-3-[6-[(2-methylpropan-2-yl)oxycarbonylamino]-3-pyridinyl]propanoic acid (PubChem CID 90975705) has the molecular formula C21H27N2O8P and a molecular weight of 466.43 g/mol. Its IUPAC name is 2-[[hydroperoxy(phenylmethoxy)phosphoryl]methyl]-3-[6-[(2-methylpropan-2-yl)oxycarbonylamino]-3-pyridinyl]propanoic acid.
| Compound Name | 2-[[hydroperoxy(phenylmethoxy)phosphoryl]methyl]-3-[6-[(2-methylpropan-2-yl)oxycarbonylamino]-3-pyridinyl]propanoic acid |
|---|---|
| PubChem CID | 90975705 |
| Molecular Formula | C21H27N2O8P |
| Molecular Weight | 466.43 g/mol |
| Exact Mass | 466.15 |
| IUPAC Name | 2-[[hydroperoxy(phenylmethoxy)phosphoryl]methyl]-3-[6-[(2-methylpropan-2-yl)oxycarbonylamino]-3-pyridinyl]propanoic acid |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(CC(CP(=O)(OO)OCc2ccccc2)C(=O)O)cn1 |
| InChI | InChI=1S/C21H27N2O8P/c1-21(2,3)30-20(26)23-18-10-9-16(12-22-18)11-17(19(24)25)14-32(28,31-27)29-13-15-7-5-4-6-8-15/h4-10,12,17,27H,11,13-14H2,1-3H3,(H,24,25)(H,22,23,26) |
| InChIKey | MSKKTEUZSGNFAE-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 144.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.43 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|