C17H22N4O2 — CID 107243153
tert-butyl N-[5-[(2-aminophenyl)methylamino]-2-pyridinyl]carbamate (PubChem CID 107243153) has the molecular formula C17H22N4O2 and a molecular weight of 314.39 g/mol. Its IUPAC name is tert-butyl N-[5-[(2-aminophenyl)methylamino]-2-pyridinyl]carbamate.
| Compound Name | tert-butyl N-[5-[(2-aminophenyl)methylamino]-2-pyridinyl]carbamate |
|---|---|
| PubChem CID | 107243153 |
| Molecular Formula | C17H22N4O2 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | tert-butyl N-[5-[(2-aminophenyl)methylamino]-2-pyridinyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(NCc2ccccc2N)cn1 |
| InChI | InChI=1S/C17H22N4O2/c1-17(2,3)23-16(22)21-15-9-8-13(11-20-15)19-10-12-6-4-5-7-14(12)18/h4-9,11,19H,10,18H2,1-3H3,(H,20,21,22) |
| InChIKey | MXLUUMBHMDZZTF-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|