C14H23N3O4S — CID 103936587
tert-butyl N-[5-(1-methylsulfonylpropan-2-ylamino)-2-pyridinyl]carbamate (PubChem CID 103936587) has the molecular formula C14H23N3O4S and a molecular weight of 329.42 g/mol. Its IUPAC name is tert-butyl N-[5-(1-methylsulfonylpropan-2-ylamino)-2-pyridinyl]carbamate.
| Compound Name | tert-butyl N-[5-(1-methylsulfonylpropan-2-ylamino)-2-pyridinyl]carbamate |
|---|---|
| PubChem CID | 103936587 |
| Molecular Formula | C14H23N3O4S |
| Molecular Weight | 329.42 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | tert-butyl N-[5-(1-methylsulfonylpropan-2-ylamino)-2-pyridinyl]carbamate |
| SMILES | CC(CS(C)(=O)=O)Nc1ccc(NC(=O)OC(C)(C)C)nc1 |
| InChI | InChI=1S/C14H23N3O4S/c1-10(9-22(5,19)20)16-11-6-7-12(15-8-11)17-13(18)21-14(2,3)4/h6-8,10,16H,9H2,1-5H3,(H,15,17,18) |
| InChIKey | WOVSKFUYIJRIHL-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.42 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |