C14H23N3O4S — CID 103387988
tert-butyl N-[2-[(6-methylsulfonyl-3-pyridinyl)amino]propyl]carbamate (PubChem CID 103387988) has the molecular formula C14H23N3O4S and a molecular weight of 329.42 g/mol. Its IUPAC name is tert-butyl N-[2-[(6-methylsulfonyl-3-pyridinyl)amino]propyl]carbamate.
| Compound Name | tert-butyl N-[2-[(6-methylsulfonyl-3-pyridinyl)amino]propyl]carbamate |
|---|---|
| PubChem CID | 103387988 |
| Molecular Formula | C14H23N3O4S |
| Molecular Weight | 329.42 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | tert-butyl N-[2-[(6-methylsulfonyl-3-pyridinyl)amino]propyl]carbamate |
| SMILES | CC(CNC(=O)OC(C)(C)C)Nc1ccc(S(C)(=O)=O)nc1 |
| InChI | InChI=1S/C14H23N3O4S/c1-10(8-16-13(18)21-14(2,3)4)17-11-6-7-12(15-9-11)22(5,19)20/h6-7,9-10,17H,8H2,1-5H3,(H,16,18) |
| InChIKey | KICCCUZOJUNEAR-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.42 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |