C15H20ClF3N2O2 — CID 103387744
tert-butyl N-[2-[4-chloro-3-(trifluoromethyl)anilino]propyl]carbamate (PubChem CID 103387744) has the molecular formula C15H20ClF3N2O2 and a molecular weight of 352.78 g/mol. Its IUPAC name is tert-butyl N-[2-[4-chloro-3-(trifluoromethyl)anilino]propyl]carbamate.
| Compound Name | tert-butyl N-[2-[4-chloro-3-(trifluoromethyl)anilino]propyl]carbamate |
|---|---|
| PubChem CID | 103387744 |
| Molecular Formula | C15H20ClF3N2O2 |
| Molecular Weight | 352.78 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | tert-butyl N-[2-[4-chloro-3-(trifluoromethyl)anilino]propyl]carbamate |
| SMILES | CC(CNC(=O)OC(C)(C)C)Nc1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H20ClF3N2O2/c1-9(8-20-13(22)23-14(2,3)4)21-10-5-6-12(16)11(7-10)15(17,18)19/h5-7,9,21H,8H2,1-4H3,(H,20,22) |
| InChIKey | YUPSQJNGUUCKNE-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.78 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |